C23H24N2O4S — CID 126214237
N-butyl-2-[(5Z)-2,4-dioxo-5-[(2-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126214237) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is N-butyl-2-[(5Z)-2,4-dioxo-5-[(2-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-butyl-2-[(5Z)-2,4-dioxo-5-[(2-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126214237 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-butyl-2-[(5Z)-2,4-dioxo-5-[(2-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CCCCNC(=O)CN1C(=O)S/C(=C\c2ccccc2OCc2ccccc2)C1=O |
| InChI | InChI=1S/C23H24N2O4S/c1-2-3-13-24-21(26)15-25-22(27)20(30-23(25)28)14-18-11-7-8-12-19(18)29-16-17-9-5-4-6-10-17/h4-12,14H,2-3,13,15-16H2,1H3,(H,24,26)/b20-14- |
| InChIKey | AGMATMSUWANBFH-ZHZULCJRSA-N |
| XLogP | 4.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|