C19H12Br2ClNO4S — CID 126277597
(5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(3,5-dibromo-2-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126277597) has the molecular formula C19H12Br2ClNO4S and a molecular weight of 545.64 g/mol. Its IUPAC name is (5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(3,5-dibromo-2-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(3,5-dibromo-2-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126277597 |
| Molecular Formula | C19H12Br2ClNO4S |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 542.85 |
| IUPAC Name | (5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(3,5-dibromo-2-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1c(Br)cc(Br)cc1/C=C1/SC(=O)N(CC(=O)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C19H12Br2ClNO4S/c1-27-17-11(6-12(20)8-14(17)21)7-16-18(25)23(19(26)28-16)9-15(24)10-2-4-13(22)5-3-10/h2-8H,9H2,1H3/b16-7+ |
| InChIKey | CWAVNRGOYGTNRF-FRKPEAEDSA-N |
| XLogP | 5.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|