C24H16BrClFNO3S — CID 124664446
(5E)-5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 124664446) has the molecular formula C24H16BrClFNO3S and a molecular weight of 532.82 g/mol. Its IUPAC name is (5E)-5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124664446 |
| Molecular Formula | C24H16BrClFNO3S |
| Molecular Weight | 532.82 g/mol |
| Exact Mass | 530.97 |
| IUPAC Name | (5E)-5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2cc(Br)ccc2OCc2ccccc2Cl)C(=O)N1Cc1ccccc1F |
| InChI | InChI=1S/C24H16BrClFNO3S/c25-18-9-10-21(31-14-16-6-1-3-7-19(16)26)17(11-18)12-22-23(29)28(24(30)32-22)13-15-5-2-4-8-20(15)27/h1-12H,13-14H2/b22-12+ |
| InChIKey | RYEAXYQEDBBGKV-WSDLNYQXSA-N |
| XLogP | 7.06 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.82 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|