C19H18Cl2N2O3S — CID 24536804
N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 24536804) has the molecular formula C19H18Cl2N2O3S and a molecular weight of 425.34 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 24536804 |
| Molecular Formula | C19H18Cl2N2O3S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | N-[2-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccc(Cl)cc2Cl)C1=O)C1CC=CCC1 |
| InChI | InChI=1S/C19H18Cl2N2O3S/c20-14-7-6-13(15(21)11-14)10-16-18(25)23(19(26)27-16)9-8-22-17(24)12-4-2-1-3-5-12/h1-2,6-7,10-12H,3-5,8-9H2,(H,22,24)/b16-10- |
| InChIKey | NLFZPUUHXNZLRW-YBEGLDIGSA-N |
| XLogP | 4.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|