C22H18ClFN2O3S — CID 55475083
2-(2-chlorophenyl)-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclopropane-1-carboxamide (PubChem CID 55475083) has the molecular formula C22H18ClFN2O3S and a molecular weight of 444.92 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclopropane-1-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 55475083 |
| Molecular Formula | C22H18ClFN2O3S |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccccc2F)C1=O)C1CC1c1ccccc1Cl |
| InChI | InChI=1S/C22H18ClFN2O3S/c23-17-7-3-2-6-14(17)15-12-16(15)20(27)25-9-10-26-21(28)19(30-22(26)29)11-13-5-1-4-8-18(13)24/h1-8,11,15-16H,9-10,12H2,(H,25,27)/b19-11- |
| InChIKey | GXCIAJYIMCPUDO-ODLFYWEKSA-N |
| XLogP | 4.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|