C22H21ClFN3O3S — CID 55354195
2-[1-(2-chlorophenyl)ethylamino]-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide (PubChem CID 55354195) has the molecular formula C22H21ClFN3O3S and a molecular weight of 461.95 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)ethylamino]-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide.
| Compound Name | 2-[1-(2-chlorophenyl)ethylamino]-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 55354195 |
| Molecular Formula | C22H21ClFN3O3S |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 2-[1-(2-chlorophenyl)ethylamino]-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
| SMILES | CC(NCC(=O)NCCN1C(=O)S/C(=C\c2ccccc2F)C1=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H21ClFN3O3S/c1-14(16-7-3-4-8-17(16)23)26-13-20(28)25-10-11-27-21(29)19(31-22(27)30)12-15-6-2-5-9-18(15)24/h2-9,12,14,26H,10-11,13H2,1H3,(H,25,28)/b19-12- |
| InChIKey | LWZVAKPJCRCKHV-UNOMPAQXSA-N |
| XLogP | 3.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|