C21H16Cl2FN3O4S — CID 24538672
N-[2-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl]-3-fluorobenzamide (PubChem CID 24538672) has the molecular formula C21H16Cl2FN3O4S and a molecular weight of 496.35 g/mol. Its IUPAC name is N-[2-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl]-3-fluorobenzamide.
| Compound Name | N-[2-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 24538672 |
| Molecular Formula | C21H16Cl2FN3O4S |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | N-[2-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl]-3-fluorobenzamide |
| SMILES | O=C(CNC(=O)c1cccc(F)c1)NCCN1C(=O)S/C(=C\c2cccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C21H16Cl2FN3O4S/c22-15-6-2-3-12(18(15)23)10-16-20(30)27(21(31)32-16)8-7-25-17(28)11-26-19(29)13-4-1-5-14(24)9-13/h1-6,9-10H,7-8,11H2,(H,25,28)(H,26,29)/b16-10- |
| InChIKey | VWCSVWAXGYWGIO-YBEGLDIGSA-N |
| XLogP | 3.71 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|