C20H16Cl2N2O5S2 — CID 26205544
N-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylsulfonylbenzamide (PubChem CID 26205544) has the molecular formula C20H16Cl2N2O5S2 and a molecular weight of 499.40 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 26205544 |
| Molecular Formula | C20H16Cl2N2O5S2 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 497.99 |
| IUPAC Name | N-[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NCCN2C(=O)S/C(=C\c3cccc(Cl)c3Cl)C2=O)cc1 |
| InChI | InChI=1S/C20H16Cl2N2O5S2/c1-31(28,29)14-7-5-12(6-8-14)18(25)23-9-10-24-19(26)16(30-20(24)27)11-13-3-2-4-15(21)17(13)22/h2-8,11H,9-10H2,1H3,(H,23,25)/b16-11- |
| InChIKey | ZGSJMLNNLAONHP-WJDWOHSUSA-N |
| XLogP | 3.86 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|