C19H13Cl3N2O3S — CID 27615662
2,3-dichloro-N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide (PubChem CID 27615662) has the molecular formula C19H13Cl3N2O3S and a molecular weight of 455.75 g/mol. Its IUPAC name is 2,3-dichloro-N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide.
| Compound Name | 2,3-dichloro-N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 27615662 |
| Molecular Formula | C19H13Cl3N2O3S |
| Molecular Weight | 455.75 g/mol |
| Exact Mass | 453.97 |
| IUPAC Name | 2,3-dichloro-N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccc(Cl)cc2)C1=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H13Cl3N2O3S/c20-12-6-4-11(5-7-12)10-15-18(26)24(19(27)28-15)9-8-23-17(25)13-2-1-3-14(21)16(13)22/h1-7,10H,8-9H2,(H,23,25)/b15-10- |
| InChIKey | WJVQXZKKHAIADS-GDNBJRDFSA-N |
| XLogP | 5.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.75 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|