C20H16Cl2N2O3S — CID 26186717
2-(4-chlorophenyl)-N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide (PubChem CID 26186717) has the molecular formula C20H16Cl2N2O3S and a molecular weight of 435.33 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 26186717 |
| Molecular Formula | C20H16Cl2N2O3S |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NCCN1C(=O)S/C(=C\c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C20H16Cl2N2O3S/c21-15-5-1-13(2-6-15)11-17-19(26)24(20(27)28-17)10-9-23-18(25)12-14-3-7-16(22)8-4-14/h1-8,11H,9-10,12H2,(H,23,25)/b17-11- |
| InChIKey | HWLLCRPAPLAKOD-BOPFTXTBSA-N |
| XLogP | 4.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|