C23H23ClN2O6S — CID 27616057
N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,3,4-trimethoxyphenyl)acetamide (PubChem CID 27616057) has the molecular formula C23H23ClN2O6S and a molecular weight of 490.97 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,3,4-trimethoxyphenyl)acetamide.
| Compound Name | N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,3,4-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 27616057 |
| Molecular Formula | C23H23ClN2O6S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,3,4-trimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCCN2C(=O)S/C(=C\c3ccc(Cl)cc3)C2=O)c(OC)c1OC |
| InChI | InChI=1S/C23H23ClN2O6S/c1-30-17-9-6-15(20(31-2)21(17)32-3)13-19(27)25-10-11-26-22(28)18(33-23(26)29)12-14-4-7-16(24)8-5-14/h4-9,12H,10-11,13H2,1-3H3,(H,25,27)/b18-12- |
| InChIKey | LFYPNGKNNLPHCM-PDGQHHTCSA-N |
| XLogP | 3.76 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|