C16H14ClF3N2O4S — CID 55719674
N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 55719674) has the molecular formula C16H14ClF3N2O4S and a molecular weight of 422.81 g/mol. Its IUPAC name is N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 55719674 |
| Molecular Formula | C16H14ClF3N2O4S |
| Molecular Weight | 422.81 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(COCC(F)(F)F)NCCN1C(=O)S/C(=C/c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C16H14ClF3N2O4S/c17-11-3-1-10(2-4-11)7-12-14(24)22(15(25)27-12)6-5-21-13(23)8-26-9-16(18,19)20/h1-4,7H,5-6,8-9H2,(H,21,23)/b12-7+ |
| InChIKey | RGGQZUDBIPWAKE-KPKJPENVSA-N |
| XLogP | 3.07 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.81 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|