C17H13ClN4O4S — CID 2562095
N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 2562095) has the molecular formula C17H13ClN4O4S and a molecular weight of 404.84 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 2562095 |
| Molecular Formula | C17H13ClN4O4S |
| Molecular Weight | 404.84 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccc(Cl)cc2)C1=O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C17H13ClN4O4S/c18-11-3-1-10(2-4-11)9-13-16(25)22(17(26)27-13)8-7-19-15(24)12-5-6-14(23)21-20-12/h1-6,9H,7-8H2,(H,19,24)(H,21,23)/b13-9- |
| InChIKey | BCNNTXNLTVGLPL-LCYFTJDESA-N |
| XLogP | 1.89 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.84 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|