C17H13BrClN3O3S — CID 55407800
4-bromo-N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 55407800) has the molecular formula C17H13BrClN3O3S and a molecular weight of 454.73 g/mol. Its IUPAC name is 4-bromo-N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55407800 |
| Molecular Formula | C17H13BrClN3O3S |
| Molecular Weight | 454.73 g/mol |
| Exact Mass | 452.95 |
| IUPAC Name | 4-bromo-N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccc(Cl)cc2)C1=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C17H13BrClN3O3S/c18-11-8-13(21-9-11)15(23)20-5-6-22-16(24)14(26-17(22)25)7-10-1-3-12(19)4-2-10/h1-4,7-9,21H,5-6H2,(H,20,23)/b14-7- |
| InChIKey | RITIWGPFPVJWAE-AUWJEWJLSA-N |
| XLogP | 3.90 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.73 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|