C20H17ClN2O3S — CID 72685511
N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-(3-chlorophenyl)acetamide (PubChem CID 72685511) has the molecular formula C20H17ClN2O3S and a molecular weight of 400.89 g/mol. Its IUPAC name is N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-(3-chlorophenyl)acetamide.
| Compound Name | N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 72685511 |
| Molecular Formula | C20H17ClN2O3S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-(3-chlorophenyl)acetamide |
| SMILES | O=C(Cc1cccc(Cl)c1)NCCN1C(=O)SC(=Cc2ccccc2)C1=O |
| InChI | InChI=1S/C20H17ClN2O3S/c21-16-8-4-7-15(11-16)13-18(24)22-9-10-23-19(25)17(27-20(23)26)12-14-5-2-1-3-6-14/h1-8,11-12H,9-10,13H2,(H,22,24) |
| InChIKey | XKMZLSIUMPWJNO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|