C19H13ClF2N2O3S — CID 3557415
N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-chloro-4,5-difluorobenzamide (PubChem CID 3557415) has the molecular formula C19H13ClF2N2O3S and a molecular weight of 422.84 g/mol. Its IUPAC name is N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-chloro-4,5-difluorobenzamide.
| Compound Name | N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-chloro-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 3557415 |
| Molecular Formula | C19H13ClF2N2O3S |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-chloro-4,5-difluorobenzamide |
| SMILES | O=C(NCCN1C(=O)SC(=Cc2ccccc2)C1=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C19H13ClF2N2O3S/c20-13-10-15(22)14(21)9-12(13)17(25)23-6-7-24-18(26)16(28-19(24)27)8-11-4-2-1-3-5-11/h1-5,8-10H,6-7H2,(H,23,25) |
| InChIKey | UHYADCQLIDQSMB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|