C20H15ClF2N2O4S — CID 3884895
2-chloro-4,5-difluoro-N-[2-[5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide (PubChem CID 3884895) has the molecular formula C20H15ClF2N2O4S and a molecular weight of 452.87 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[2-[5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[2-[5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 3884895 |
| Molecular Formula | C20H15ClF2N2O4S |
| Molecular Weight | 452.87 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[2-[5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
| SMILES | COc1ccc(C=C2SC(=O)N(CCNC(=O)c3cc(F)c(F)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C20H15ClF2N2O4S/c1-29-12-4-2-11(3-5-12)8-17-19(27)25(20(28)30-17)7-6-24-18(26)13-9-15(22)16(23)10-14(13)21/h2-5,8-10H,6-7H2,1H3,(H,24,26) |
| InChIKey | JOPDTHGREZNALC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.87 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|