C26H21F2N3O6S2 — CID 4311273
4-[(3,4-difluorophenyl)sulfonylamino]-N-[2-[5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide (PubChem CID 4311273) has the molecular formula C26H21F2N3O6S2 and a molecular weight of 573.60 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)sulfonylamino]-N-[2-[5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide.
| Compound Name | 4-[(3,4-difluorophenyl)sulfonylamino]-N-[2-[5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 4311273 |
| Molecular Formula | C26H21F2N3O6S2 |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.08 |
| IUPAC Name | 4-[(3,4-difluorophenyl)sulfonylamino]-N-[2-[5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
| SMILES | COc1ccc(C=C2SC(=O)N(CCNC(=O)c3ccc(NS(=O)(=O)c4ccc(F)c(F)c4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H21F2N3O6S2/c1-37-19-8-2-16(3-9-19)14-23-25(33)31(26(34)38-23)13-12-29-24(32)17-4-6-18(7-5-17)30-39(35,36)20-10-11-21(27)22(28)15-20/h2-11,14-15,30H,12-13H2,1H3,(H,29,32) |
| InChIKey | DNDXLJSXKLJAKO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|