C24H24ClN3O5S2 — CID 4844563
N-[2-[5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 4844563) has the molecular formula C24H24ClN3O5S2 and a molecular weight of 534.06 g/mol. Its IUPAC name is N-[2-[5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-[5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 4844563 |
| Molecular Formula | C24H24ClN3O5S2 |
| Molecular Weight | 534.06 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | N-[2-[5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCCN1C(=O)SC(=Cc2ccc(Cl)cc2)C1=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H24ClN3O5S2/c25-19-8-4-17(5-9-19)16-21-23(30)28(24(31)34-21)15-12-26-22(29)18-6-10-20(11-7-18)35(32,33)27-13-2-1-3-14-27/h4-11,16H,1-3,12-15H2,(H,26,29) |
| InChIKey | HLKJEEONLLUPHK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.06 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|