C26H28ClN3O7S2 — CID 98401304
2-chloro-N-[2-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 98401304) has the molecular formula C26H28ClN3O7S2 and a molecular weight of 594.11 g/mol. Its IUPAC name is 2-chloro-N-[2-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[2-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 98401304 |
| Molecular Formula | C26H28ClN3O7S2 |
| Molecular Weight | 594.11 g/mol |
| Exact Mass | 593.11 |
| IUPAC Name | 2-chloro-N-[2-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(/C=C2/SC(=O)N(CCNC(=O)c3cc(S(=O)(=O)N4CCCCC4)ccc3Cl)C2=O)cc1OC |
| InChI | InChI=1S/C26H28ClN3O7S2/c1-36-21-9-6-17(14-22(21)37-2)15-23-25(32)30(26(33)38-23)13-10-28-24(31)19-16-18(7-8-20(19)27)39(34,35)29-11-4-3-5-12-29/h6-9,14-16H,3-5,10-13H2,1-2H3,(H,28,31)/b23-15+ |
| InChIKey | OKNIQRSXDPRIOA-HZHRSRAPSA-N |
| XLogP | 4.00 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.11 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|