C28H33N3O6S2 — CID 6389065
N-[2-[(5E)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 6389065) has the molecular formula C28H33N3O6S2 and a molecular weight of 571.72 g/mol. Its IUPAC name is N-[2-[(5E)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-[(5E)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 6389065 |
| Molecular Formula | C28H33N3O6S2 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | N-[2-[(5E)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | COc1ccc(/C=C2/SC(=O)N(CCNC(=O)C3CCN(S(=O)(=O)c4ccc(C(C)C)cc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C28H33N3O6S2/c1-19(2)21-6-10-24(11-7-21)39(35,36)30-15-12-22(13-16-30)26(32)29-14-17-31-27(33)25(38-28(31)34)18-20-4-8-23(37-3)9-5-20/h4-11,18-19,22H,12-17H2,1-3H3,(H,29,32)/b25-18+ |
| InChIKey | KLJBBABPGKWQGK-XIEYBQDHSA-N |
| XLogP | 4.07 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|