C26H26ClN3O5S — CID 16547499
1-(4-chlorobenzoyl)-N-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]piperidine-4-carboxamide (PubChem CID 16547499) has the molecular formula C26H26ClN3O5S and a molecular weight of 528.03 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 16547499 |
| Molecular Formula | C26H26ClN3O5S |
| Molecular Weight | 528.03 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-[2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(/C=C2\SC(=O)N(CCNC(=O)C3CCN(C(=O)c4ccc(Cl)cc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C26H26ClN3O5S/c1-35-21-8-2-17(3-9-21)16-22-25(33)30(26(34)36-22)15-12-28-23(31)18-10-13-29(14-11-18)24(32)19-4-6-20(27)7-5-19/h2-9,16,18H,10-15H2,1H3,(H,28,31)/b22-16- |
| InChIKey | VCHYJXWVKKYUGM-JWGURIENSA-N |
| XLogP | 4.05 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.03 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|