C22H23N3O5S3 — CID 93030306
N-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 93030306) has the molecular formula C22H23N3O5S3 and a molecular weight of 505.64 g/mol. Its IUPAC name is N-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 93030306 |
| Molecular Formula | C22H23N3O5S3 |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | N-[2-[(5E)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C/c2ccccc2)C1=O)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C22H23N3O5S3/c26-20(17-8-11-24(12-9-17)33(29,30)19-7-4-14-31-19)23-10-13-25-21(27)18(32-22(25)28)15-16-5-2-1-3-6-16/h1-7,14-15,17H,8-13H2,(H,23,26)/b18-15+ |
| InChIKey | IYFHVTJKWKVBCO-OBGWFSINSA-N |
| XLogP | 3.00 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|