C19H18FN3O5S3 — CID 30275890
N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide (PubChem CID 30275890) has the molecular formula C19H18FN3O5S3 and a molecular weight of 483.57 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide.
| Compound Name | N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 30275890 |
| Molecular Formula | C19H18FN3O5S3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
| SMILES | CN(CC(=O)NCCN1C(=O)S/C(=C\c2ccc(F)cc2)C1=O)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H18FN3O5S3/c1-22(31(27,28)17-3-2-10-29-17)12-16(24)21-8-9-23-18(25)15(30-19(23)26)11-13-4-6-14(20)7-5-13/h2-7,10-11H,8-9,12H2,1H3,(H,21,24)/b15-11- |
| InChIKey | ASLHUJYUJOBSLP-PTNGSMBKSA-N |
| XLogP | 2.36 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|