C19H21F3N2O3S2 — CID 26594377
1-thiophen-2-ylsulfonyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]piperidine-4-carboxamide (PubChem CID 26594377) has the molecular formula C19H21F3N2O3S2 and a molecular weight of 446.52 g/mol. Its IUPAC name is 1-thiophen-2-ylsulfonyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-thiophen-2-ylsulfonyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26594377 |
| Molecular Formula | C19H21F3N2O3S2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 1-thiophen-2-ylsulfonyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCc1ccc(C(F)(F)F)cc1)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C19H21F3N2O3S2/c20-19(21,22)16-5-3-14(4-6-16)7-10-23-18(25)15-8-11-24(12-9-15)29(26,27)17-2-1-13-28-17/h1-6,13,15H,7-12H2,(H,23,25) |
| InChIKey | UTFVAXOCSRUMCT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |