C19H22Cl2N2O3S3 — CID 92642404
N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 92642404) has the molecular formula C19H22Cl2N2O3S3 and a molecular weight of 493.50 g/mol. Its IUPAC name is N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 92642404 |
| Molecular Formula | C19H22Cl2N2O3S3 |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCCSCc1c(Cl)cccc1Cl)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C19H22Cl2N2O3S3/c20-16-3-1-4-17(21)15(16)13-27-12-8-22-19(24)14-6-9-23(10-7-14)29(25,26)18-5-2-11-28-18/h1-5,11,14H,6-10,12-13H2,(H,22,24) |
| InChIKey | YOUYVOPSKZZWKH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|