C16H22Cl2N2OS — CID 99970124
(3S)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-methylpiperidine-3-carboxamide (PubChem CID 99970124) has the molecular formula C16H22Cl2N2OS and a molecular weight of 361.34 g/mol. Its IUPAC name is (3S)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-methylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 99970124 |
| Molecular Formula | C16H22Cl2N2OS |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (3S)-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-1-methylpiperidine-3-carboxamide |
| SMILES | CN1CCC[C@H](C(=O)NCCSCc2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C16H22Cl2N2OS/c1-20-8-3-4-12(10-20)16(21)19-7-9-22-11-13-14(17)5-2-6-15(13)18/h2,5-6,12H,3-4,7-11H2,1H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | VZFOFTUBCYGLEX-LBPRGKRZSA-N |
| XLogP | 3.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|