C19H22ClFN2O3S3 — CID 92802325
(3R)-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 92802325) has the molecular formula C19H22ClFN2O3S3 and a molecular weight of 477.05 g/mol. Its IUPAC name is (3R)-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92802325 |
| Molecular Formula | C19H22ClFN2O3S3 |
| Molecular Weight | 477.05 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | (3R)-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NCCSCc1c(F)cccc1Cl)[C@@H]1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C19H22ClFN2O3S3/c20-16-5-1-6-17(21)15(16)13-27-11-8-22-19(24)14-4-2-9-23(12-14)29(25,26)18-7-3-10-28-18/h1,3,5-7,10,14H,2,4,8-9,11-13H2,(H,22,24)/t14-/m1/s1 |
| InChIKey | GZTXORVTUWOUJG-CQSZACIVSA-N |
| XLogP | 3.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.05 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|