C17H27N3O3S2 — CID 94019515
(3R)-N-(3-pyrrolidin-1-ylpropyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 94019515) has the molecular formula C17H27N3O3S2 and a molecular weight of 385.56 g/mol. Its IUPAC name is (3R)-N-(3-pyrrolidin-1-ylpropyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-(3-pyrrolidin-1-ylpropyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94019515 |
| Molecular Formula | C17H27N3O3S2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (3R)-N-(3-pyrrolidin-1-ylpropyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCCC1)[C@@H]1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C17H27N3O3S2/c21-17(18-8-5-11-19-9-1-2-10-19)15-6-3-12-20(14-15)25(22,23)16-7-4-13-24-16/h4,7,13,15H,1-3,5-6,8-12,14H2,(H,18,21)/t15-/m1/s1 |
| InChIKey | PESYLEFRNKCUKW-OAHLLOKOSA-N |
| XLogP | 1.75 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|