C18H30N4O3S2 — CID 43905757
N-[3-(4-methylpiperazin-1-yl)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 43905757) has the molecular formula C18H30N4O3S2 and a molecular weight of 414.60 g/mol. Its IUPAC name is N-[3-(4-methylpiperazin-1-yl)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[3-(4-methylpiperazin-1-yl)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 43905757 |
| Molecular Formula | C18H30N4O3S2 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[3-(4-methylpiperazin-1-yl)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | CN1CCN(CCCNC(=O)C2CCCN(S(=O)(=O)c3cccs3)C2)CC1 |
| InChI | InChI=1S/C18H30N4O3S2/c1-20-10-12-21(13-11-20)8-4-7-19-18(23)16-5-2-9-22(15-16)27(24,25)17-6-3-14-26-17/h3,6,14,16H,2,4-5,7-13,15H2,1H3,(H,19,23) |
| InChIKey | LQYBJCSAJMEXEC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|