C15H25N3O3S2 — CID 38017869
(3S)-N-[3-(dimethylamino)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 38017869) has the molecular formula C15H25N3O3S2 and a molecular weight of 359.52 g/mol. Its IUPAC name is (3S)-N-[3-(dimethylamino)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-(dimethylamino)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 38017869 |
| Molecular Formula | C15H25N3O3S2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (3S)-N-[3-(dimethylamino)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)[C@H]1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C15H25N3O3S2/c1-17(2)9-5-8-16-15(19)13-6-3-10-18(12-13)23(20,21)14-7-4-11-22-14/h4,7,11,13H,3,5-6,8-10,12H2,1-2H3,(H,16,19)/t13-/m0/s1 |
| InChIKey | YRTKDBVKAZJDFE-ZDUSSCGKSA-N |
| XLogP | 1.22 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|