C18H28N2O3S3 — CID 92802318
(3S)-N-(2-cyclohexylsulfanylethyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 92802318) has the molecular formula C18H28N2O3S3 and a molecular weight of 416.63 g/mol. Its IUPAC name is (3S)-N-(2-cyclohexylsulfanylethyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-(2-cyclohexylsulfanylethyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92802318 |
| Molecular Formula | C18H28N2O3S3 |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (3S)-N-(2-cyclohexylsulfanylethyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NCCSC1CCCCC1)[C@H]1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C18H28N2O3S3/c21-18(19-10-13-24-16-7-2-1-3-8-16)15-6-4-11-20(14-15)26(22,23)17-9-5-12-25-17/h5,9,12,15-16H,1-4,6-8,10-11,13-14H2,(H,19,21)/t15-/m0/s1 |
| InChIKey | NCYLDIOHEQWBDA-HNNXBMFYSA-N |
| XLogP | 3.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|