C16H22N4O3S3 — CID 40971950
(3R)-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 40971950) has the molecular formula C16H22N4O3S3 and a molecular weight of 414.58 g/mol. Its IUPAC name is (3R)-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 40971950 |
| Molecular Formula | C16H22N4O3S3 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | (3R)-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | Cn1ccnc1SCCNC(=O)[C@@H]1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C16H22N4O3S3/c1-19-9-6-18-16(19)25-11-7-17-15(21)13-4-2-8-20(12-13)26(22,23)14-5-3-10-24-14/h3,5-6,9-10,13H,2,4,7-8,11-12H2,1H3,(H,17,21)/t13-/m1/s1 |
| InChIKey | LYYQRPAOOJIEKR-CYBMUJFWSA-N |
| XLogP | 1.79 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|