C19H24N2O5S2 — CID 94111152
(3R)-N-[2-(3-methoxyphenoxy)ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 94111152) has the molecular formula C19H24N2O5S2 and a molecular weight of 424.54 g/mol. Its IUPAC name is (3R)-N-[2-(3-methoxyphenoxy)ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[2-(3-methoxyphenoxy)ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94111152 |
| Molecular Formula | C19H24N2O5S2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (3R)-N-[2-(3-methoxyphenoxy)ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | COc1cccc(OCCNC(=O)[C@@H]2CCCN(S(=O)(=O)c3cccs3)C2)c1 |
| InChI | InChI=1S/C19H24N2O5S2/c1-25-16-6-2-7-17(13-16)26-11-9-20-19(22)15-5-3-10-21(14-15)28(23,24)18-8-4-12-27-18/h2,4,6-8,12-13,15H,3,5,9-11,14H2,1H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | ZZRZMHNDGGWYPB-OAHLLOKOSA-N |
| XLogP | 2.35 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|