C20H26N2O4S2 — CID 38011691
(3R)-N-[3-(4-methoxyphenyl)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 38011691) has the molecular formula C20H26N2O4S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is (3R)-N-[3-(4-methoxyphenyl)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[3-(4-methoxyphenyl)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 38011691 |
| Molecular Formula | C20H26N2O4S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (3R)-N-[3-(4-methoxyphenyl)propyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | COc1ccc(CCCNC(=O)[C@@H]2CCCN(S(=O)(=O)c3cccs3)C2)cc1 |
| InChI | InChI=1S/C20H26N2O4S2/c1-26-18-10-8-16(9-11-18)5-2-12-21-20(23)17-6-3-13-22(15-17)28(24,25)19-7-4-14-27-19/h4,7-11,14,17H,2-3,5-6,12-13,15H2,1H3,(H,21,23)/t17-/m1/s1 |
| InChIKey | NFZGUWDUMLIWTM-QGZVFWFLSA-N |
| XLogP | 2.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|