C18H31N3O3S2 — CID 55451031
N-[2-[di(propan-2-yl)amino]ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 55451031) has the molecular formula C18H31N3O3S2 and a molecular weight of 401.60 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55451031 |
| Molecular Formula | C18H31N3O3S2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | CC(C)N(CCNC(=O)C1CCCN(S(=O)(=O)c2cccs2)C1)C(C)C |
| InChI | InChI=1S/C18H31N3O3S2/c1-14(2)21(15(3)4)11-9-19-18(22)16-7-5-10-20(13-16)26(23,24)17-8-6-12-25-17/h6,8,12,14-16H,5,7,9-11,13H2,1-4H3,(H,19,22) |
| InChIKey | QHTJREYVZOYOCO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |