C22H24N2O3S2 — CID 46442413
N-(2-naphthalen-1-ylethyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 46442413) has the molecular formula C22H24N2O3S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-(2-naphthalen-1-ylethyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2-naphthalen-1-ylethyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46442413 |
| Molecular Formula | C22H24N2O3S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-(2-naphthalen-1-ylethyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NCCc1cccc2ccccc12)C1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C22H24N2O3S2/c25-22(23-13-12-18-8-3-7-17-6-1-2-10-20(17)18)19-9-4-14-24(16-19)29(26,27)21-11-5-15-28-21/h1-3,5-8,10-11,15,19H,4,9,12-14,16H2,(H,23,25) |
| InChIKey | CGGSKNUXHDGJSK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |