C20H27N3O6S — CID 55586189
1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[2-(3-methoxyphenoxy)ethyl]piperidine-3-carboxamide (PubChem CID 55586189) has the molecular formula C20H27N3O6S and a molecular weight of 437.52 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[2-(3-methoxyphenoxy)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[2-(3-methoxyphenoxy)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55586189 |
| Molecular Formula | C20H27N3O6S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[2-(3-methoxyphenoxy)ethyl]piperidine-3-carboxamide |
| SMILES | COc1cccc(OCCNC(=O)C2CCCN(S(=O)(=O)c3c(C)noc3C)C2)c1 |
| InChI | InChI=1S/C20H27N3O6S/c1-14-19(15(2)29-22-14)30(25,26)23-10-5-6-16(13-23)20(24)21-9-11-28-18-8-4-7-17(12-18)27-3/h4,7-8,12,16H,5-6,9-11,13H2,1-3H3,(H,21,24) |
| InChIKey | BIEMZUXPHSJNMG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|