C21H29N3O7S — CID 55624392
1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]piperidine-3-carboxamide (PubChem CID 55624392) has the molecular formula C21H29N3O7S and a molecular weight of 467.54 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55624392 |
| Molecular Formula | C21H29N3O7S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]piperidine-3-carboxamide |
| SMILES | COCCOc1cc(NC(=O)C2CCCN(S(=O)(=O)c3c(C)noc3C)C2)ccc1OC |
| InChI | InChI=1S/C21H29N3O7S/c1-14-20(15(2)31-23-14)32(26,27)24-9-5-6-16(13-24)21(25)22-17-7-8-18(29-4)19(12-17)30-11-10-28-3/h7-8,12,16H,5-6,9-11,13H2,1-4H3,(H,22,25) |
| InChIKey | LEZALCLJUQFTPW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 120.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|