C19H27ClN2O3S2 — CID 32543820
(3S)-1-(4-chlorophenyl)sulfonyl-N-(2-cyclopentylsulfanylethyl)piperidine-3-carboxamide (PubChem CID 32543820) has the molecular formula C19H27ClN2O3S2 and a molecular weight of 431.02 g/mol. Its IUPAC name is (3S)-1-(4-chlorophenyl)sulfonyl-N-(2-cyclopentylsulfanylethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-chlorophenyl)sulfonyl-N-(2-cyclopentylsulfanylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 32543820 |
| Molecular Formula | C19H27ClN2O3S2 |
| Molecular Weight | 431.02 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | (3S)-1-(4-chlorophenyl)sulfonyl-N-(2-cyclopentylsulfanylethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCSC1CCCC1)[C@H]1CCCN(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H27ClN2O3S2/c20-16-7-9-18(10-8-16)27(24,25)22-12-3-4-15(14-22)19(23)21-11-13-26-17-5-1-2-6-17/h7-10,15,17H,1-6,11-14H2,(H,21,23)/t15-/m0/s1 |
| InChIKey | DPLGMKIEMJFBIT-HNNXBMFYSA-N |
| XLogP | 3.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.02 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|