C17H24ClN3O5S — CID 56558612
ethyl N-[2-[[1-(4-chlorophenyl)sulfonylpiperidine-3-carbonyl]amino]ethyl]carbamate (PubChem CID 56558612) has the molecular formula C17H24ClN3O5S and a molecular weight of 417.92 g/mol. Its IUPAC name is ethyl N-[2-[[1-(4-chlorophenyl)sulfonylpiperidine-3-carbonyl]amino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[[1-(4-chlorophenyl)sulfonylpiperidine-3-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 56558612 |
| Molecular Formula | C17H24ClN3O5S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | ethyl N-[2-[[1-(4-chlorophenyl)sulfonylpiperidine-3-carbonyl]amino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)C1CCCN(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H24ClN3O5S/c1-2-26-17(23)20-10-9-19-16(22)13-4-3-11-21(12-13)27(24,25)15-7-5-14(18)6-8-15/h5-8,13H,2-4,9-12H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | AAXHEBCKWAPGLY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|