C21H24Cl2N2O3S2 — CID 133189420
N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-1-(4-chlorophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 133189420) has the molecular formula C21H24Cl2N2O3S2 and a molecular weight of 487.47 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-1-(4-chlorophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-1-(4-chlorophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 133189420 |
| Molecular Formula | C21H24Cl2N2O3S2 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-1-(4-chlorophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NCCSCc1cccc(Cl)c1)C1CCCN(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C21H24Cl2N2O3S2/c22-18-6-8-20(9-7-18)30(27,28)25-11-2-4-17(14-25)21(26)24-10-12-29-15-16-3-1-5-19(23)13-16/h1,3,5-9,13,17H,2,4,10-12,14-15H2,(H,24,26) |
| InChIKey | UHOUSXODNLUKQF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|