C16H22ClN3O2S — CID 70742198
3-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]piperidine-1,3-dicarboxamide (PubChem CID 70742198) has the molecular formula C16H22ClN3O2S and a molecular weight of 355.89 g/mol. Its IUPAC name is 3-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 70742198 |
| Molecular Formula | C16H22ClN3O2S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 3-N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CCCC(C(=O)NCCSCc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C16H22ClN3O2S/c17-14-5-1-3-12(9-14)11-23-8-6-19-15(21)13-4-2-7-20(10-13)16(18)22/h1,3,5,9,13H,2,4,6-8,10-11H2,(H2,18,22)(H,19,21) |
| InChIKey | YLZUJQSAVXHRCQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|