C15H20ClNOS — CID 100773197
N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide (PubChem CID 100773197) has the molecular formula C15H20ClNOS and a molecular weight of 297.85 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 100773197 |
| Molecular Formula | C15H20ClNOS |
| Molecular Weight | 297.85 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]cyclopentanecarboxamide |
| SMILES | O=C(NCCSCc1cccc(Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C15H20ClNOS/c16-14-7-3-4-12(10-14)11-19-9-8-17-15(18)13-5-1-2-6-13/h3-4,7,10,13H,1-2,5-6,8-9,11H2,(H,17,18) |
| InChIKey | CGZZSDPESMQKBY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.85 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|