C17H24ClN3O2S — CID 119479747
N-(2-aminoethyl)-1-[2-[(3-chlorophenyl)methylsulfanyl]acetyl]piperidine-3-carboxamide (PubChem CID 119479747) has the molecular formula C17H24ClN3O2S and a molecular weight of 369.92 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[2-[(3-chlorophenyl)methylsulfanyl]acetyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[2-[(3-chlorophenyl)methylsulfanyl]acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119479747 |
| Molecular Formula | C17H24ClN3O2S |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-(2-aminoethyl)-1-[2-[(3-chlorophenyl)methylsulfanyl]acetyl]piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(C(=O)CSCc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C17H24ClN3O2S/c18-15-5-1-3-13(9-15)11-24-12-16(22)21-8-2-4-14(10-21)17(23)20-7-6-19/h1,3,5,9,14H,2,4,6-8,10-12,19H2,(H,20,23) |
| InChIKey | UXESNEFKDUGAOZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |