C15H18ClNO3S — CID 112733586
methyl 1-[2-[(3-chlorophenyl)methylsulfanyl]acetyl]pyrrolidine-3-carboxylate (PubChem CID 112733586) has the molecular formula C15H18ClNO3S and a molecular weight of 327.83 g/mol. Its IUPAC name is methyl 1-[2-[(3-chlorophenyl)methylsulfanyl]acetyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-[2-[(3-chlorophenyl)methylsulfanyl]acetyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 112733586 |
| Molecular Formula | C15H18ClNO3S |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | methyl 1-[2-[(3-chlorophenyl)methylsulfanyl]acetyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CSCc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C15H18ClNO3S/c1-20-15(19)12-5-6-17(8-12)14(18)10-21-9-11-3-2-4-13(16)7-11/h2-4,7,12H,5-6,8-10H2,1H3 |
| InChIKey | CTSGNNUDJXHLLE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |