C17H21ClN2O2S — CID 78778947
2-[(3-chlorophenyl)methylsulfanyl]-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]ethanone (PubChem CID 78778947) has the molecular formula C17H21ClN2O2S and a molecular weight of 352.89 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylsulfanyl]-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(3-chlorophenyl)methylsulfanyl]-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 78778947 |
| Molecular Formula | C17H21ClN2O2S |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-[(3-chlorophenyl)methylsulfanyl]-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CSCc1cccc(Cl)c1)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C17H21ClN2O2S/c18-15-3-1-2-13(10-15)11-23-12-16(21)19-6-8-20(9-7-19)17(22)14-4-5-14/h1-3,10,14H,4-9,11-12H2 |
| InChIKey | PFWZDVNISSAWAN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |