C18H19ClN2O3S — CID 134021917
2-[(3-chlorophenyl)methylsulfanyl]-1-[4-(furan-3-carbonyl)piperazin-1-yl]ethanone (PubChem CID 134021917) has the molecular formula C18H19ClN2O3S and a molecular weight of 378.88 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylsulfanyl]-1-[4-(furan-3-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(3-chlorophenyl)methylsulfanyl]-1-[4-(furan-3-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 134021917 |
| Molecular Formula | C18H19ClN2O3S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-[(3-chlorophenyl)methylsulfanyl]-1-[4-(furan-3-carbonyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CSCc1cccc(Cl)c1)N1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C18H19ClN2O3S/c19-16-3-1-2-14(10-16)12-25-13-17(22)20-5-7-21(8-6-20)18(23)15-4-9-24-11-15/h1-4,9-11H,5-8,12-13H2 |
| InChIKey | VOKNLBSSTREKRU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |