C19H20Cl2N2OS — CID 55345654
2-[(3-chlorophenyl)methylsulfanyl]-1-[4-(3-chlorophenyl)piperazin-1-yl]ethanone (PubChem CID 55345654) has the molecular formula C19H20Cl2N2OS and a molecular weight of 395.36 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylsulfanyl]-1-[4-(3-chlorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(3-chlorophenyl)methylsulfanyl]-1-[4-(3-chlorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55345654 |
| Molecular Formula | C19H20Cl2N2OS |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-[(3-chlorophenyl)methylsulfanyl]-1-[4-(3-chlorophenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CSCc1cccc(Cl)c1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H20Cl2N2OS/c20-16-4-1-3-15(11-16)13-25-14-19(24)23-9-7-22(8-10-23)18-6-2-5-17(21)12-18/h1-6,11-12H,7-10,13-14H2 |
| InChIKey | KMHRLJXZNMGZIB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |