C20H21ClN4OS — CID 2090188
2-(1H-benzimidazol-2-ylmethylsulfanyl)-1-[4-(3-chlorophenyl)piperazin-1-yl]ethanone (PubChem CID 2090188) has the molecular formula C20H21ClN4OS and a molecular weight of 400.94 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylmethylsulfanyl)-1-[4-(3-chlorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-1-[4-(3-chlorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 2090188 |
| Molecular Formula | C20H21ClN4OS |
| Molecular Weight | 400.94 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-1-[4-(3-chlorophenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CSCc1nc2ccccc2[nH]1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H21ClN4OS/c21-15-4-3-5-16(12-15)24-8-10-25(11-9-24)20(26)14-27-13-19-22-17-6-1-2-7-18(17)23-19/h1-7,12H,8-11,13-14H2,(H,22,23) |
| InChIKey | FXLZIWSUWYRMTB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.94 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |